C22H21ClF2N6O2S — CID 164725846
5-[[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]methyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 164725846) has the molecular formula C22H21ClF2N6O2S and a molecular weight of 506.97 g/mol. Its IUPAC name is 5-[[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]methyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]methyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 164725846 |
| Molecular Formula | C22H21ClF2N6O2S |
| Molecular Weight | 506.97 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 5-[[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]methyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3cn(Cc4ccc5[nH]c(=O)[nH]c5c4)nn3)N1)OCC(F)(F)c1cc(Cl)sc12 |
| InChI | InChI=1S/C22H21ClF2N6O2S/c1-11-6-21(19-13(5-18(23)34-19)22(24,25)10-33-21)7-16(26-11)17-9-31(30-29-17)8-12-2-3-14-15(4-12)28-20(32)27-14/h2-5,9,11,16,26H,6-8,10H2,1H3,(H2,27,28,32)/t11-,16-,21-/m0/s1 |
| InChIKey | HXCZBTWJFUKSTP-VQDICGIKSA-N |
| XLogP | 4.04 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.97 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |