C20H23ClF2N6OS — CID 164726084
(2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-[1-[2-(5-methylpyrazol-1-yl)ethyl]triazol-4-yl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 164726084) has the molecular formula C20H23ClF2N6OS and a molecular weight of 468.96 g/mol. Its IUPAC name is (2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-[1-[2-(5-methylpyrazol-1-yl)ethyl]triazol-4-yl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | (2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-[1-[2-(5-methylpyrazol-1-yl)ethyl]triazol-4-yl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 164726084 |
| Molecular Formula | C20H23ClF2N6OS |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | (2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-[1-[2-(5-methylpyrazol-1-yl)ethyl]triazol-4-yl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | Cc1ccnn1CCn1cc([C@@H]2C[C@]3(C[C@H](C)N2)OCC(F)(F)c2cc(Cl)sc23)nn1 |
| InChI | InChI=1S/C20H23ClF2N6OS/c1-12-8-19(18-14(7-17(21)31-18)20(22,23)11-30-19)9-15(25-12)16-10-28(27-26-16)5-6-29-13(2)3-4-24-29/h3-4,7,10,12,15,25H,5-6,8-9,11H2,1-2H3/t12-,15-,19-/m0/s1 |
| InChIKey | WFWYIRJANDURMO-ODYMNIRHSA-N |
| XLogP | 4.03 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |