C21H29ClN4O4S — CID 164725636
(2'S,4S,6'S,7S)-2-chloro-2'-[1-[[4-(hydroxymethyl)oxan-4-yl]methyl]triazol-4-yl]-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol (PubChem CID 164725636) has the molecular formula C21H29ClN4O4S and a molecular weight of 469.01 g/mol. Its IUPAC name is (2'S,4S,6'S,7S)-2-chloro-2'-[1-[[4-(hydroxymethyl)oxan-4-yl]methyl]triazol-4-yl]-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol.
| Compound Name | (2'S,4S,6'S,7S)-2-chloro-2'-[1-[[4-(hydroxymethyl)oxan-4-yl]methyl]triazol-4-yl]-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol |
|---|---|
| PubChem CID | 164725636 |
| Molecular Formula | C21H29ClN4O4S |
| Molecular Weight | 469.01 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | (2'S,4S,6'S,7S)-2-chloro-2'-[1-[[4-(hydroxymethyl)oxan-4-yl]methyl]triazol-4-yl]-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3cn(CC4(CO)CCOCC4)nn3)N1)OC[C@@H](O)c1cc(Cl)sc12 |
| InChI | InChI=1S/C21H29ClN4O4S/c1-13-7-21(19-14(6-18(22)31-19)17(28)10-30-21)8-15(23-13)16-9-26(25-24-16)11-20(12-27)2-4-29-5-3-20/h6,9,13,15,17,23,27-28H,2-5,7-8,10-12H2,1H3/t13-,15-,17+,21-/m0/s1 |
| InChIKey | GHOZVSLZBCSLNB-PDVSYCDBSA-N |
| XLogP | 2.55 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.01 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |