C20H25ClF2N4O2S — CID 164725620
(2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-[1-(oxan-4-ylmethyl)triazol-4-yl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 164725620) has the molecular formula C20H25ClF2N4O2S and a molecular weight of 458.96 g/mol. Its IUPAC name is (2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-[1-(oxan-4-ylmethyl)triazol-4-yl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | (2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-[1-(oxan-4-ylmethyl)triazol-4-yl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 164725620 |
| Molecular Formula | C20H25ClF2N4O2S |
| Molecular Weight | 458.96 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | (2'S,6'S,7S)-2-chloro-4,4-difluoro-2'-methyl-6'-[1-(oxan-4-ylmethyl)triazol-4-yl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3cn(CC4CCOCC4)nn3)N1)OCC(F)(F)c1cc(Cl)sc12 |
| InChI | InChI=1S/C20H25ClF2N4O2S/c1-12-7-19(18-14(6-17(21)30-18)20(22,23)11-29-19)8-15(24-12)16-10-27(26-25-16)9-13-2-4-28-5-3-13/h6,10,12-13,15,24H,2-5,7-9,11H2,1H3/t12-,15-,19-/m0/s1 |
| InChIKey | VXACEDXFMNRLFE-ODYMNIRHSA-N |
| XLogP | 4.25 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.96 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |