C18H23ClF2N4O3S — CID 164726170
1-[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]-3-methoxypropan-2-ol (PubChem CID 164726170) has the molecular formula C18H23ClF2N4O3S and a molecular weight of 448.92 g/mol. Its IUPAC name is 1-[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]-3-methoxypropan-2-ol.
| Compound Name | 1-[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 164726170 |
| Molecular Formula | C18H23ClF2N4O3S |
| Molecular Weight | 448.92 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 1-[4-[(2'S,6'S,7S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]-3-methoxypropan-2-ol |
| SMILES | COCC(O)Cn1cc([C@@H]2C[C@]3(C[C@H](C)N2)OCC(F)(F)c2cc(Cl)sc23)nn1 |
| InChI | InChI=1S/C18H23ClF2N4O3S/c1-10-4-17(16-12(3-15(19)29-16)18(20,21)9-28-17)5-13(22-10)14-7-25(24-23-14)6-11(26)8-27-2/h3,7,10-11,13,22,26H,4-6,8-9H2,1-2H3/t10-,11?,13-,17-/m0/s1 |
| InChIKey | VNNDTJIHKJQNRW-XBVQHMAPSA-N |
| XLogP | 2.83 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.92 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |