C21H21FN4O3 — CID 76759396
5-fluoro-N-[(4-methoxyphenyl)methyl]-2-[(4-methoxyphenyl)methylideneamino]oxy-N-methylpyrimidin-4-amine (PubChem CID 76759396) has the molecular formula C21H21FN4O3 and a molecular weight of 396.42 g/mol. Its IUPAC name is 5-fluoro-N-[(4-methoxyphenyl)methyl]-2-[(4-methoxyphenyl)methylideneamino]oxy-N-methylpyrimidin-4-amine.
| Compound Name | 5-fluoro-N-[(4-methoxyphenyl)methyl]-2-[(4-methoxyphenyl)methylideneamino]oxy-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 76759396 |
| Molecular Formula | C21H21FN4O3 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 5-fluoro-N-[(4-methoxyphenyl)methyl]-2-[(4-methoxyphenyl)methylideneamino]oxy-N-methylpyrimidin-4-amine |
| SMILES | COc1ccc(C=NOc2ncc(F)c(N(C)Cc3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C21H21FN4O3/c1-26(14-16-6-10-18(28-3)11-7-16)20-19(22)13-23-21(25-20)29-24-12-15-4-8-17(27-2)9-5-15/h4-13H,14H2,1-3H3 |
| InChIKey | GGDTVJXXWNXCJW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 69.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|