C12H28N4 — CID 76763916
1,1-dipropyl-2-[(1S)-1-(propyldiazenyl)propyl]hydrazine (PubChem CID 76763916) has the molecular formula C12H28N4 and a molecular weight of 228.38 g/mol. Its IUPAC name is 1,1-dipropyl-2-[(1S)-1-(propyldiazenyl)propyl]hydrazine.
| Compound Name | 1,1-dipropyl-2-[(1S)-1-(propyldiazenyl)propyl]hydrazine |
|---|---|
| PubChem CID | 76763916 |
| Molecular Formula | C12H28N4 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.23 |
| IUPAC Name | 1,1-dipropyl-2-[(1S)-1-(propyldiazenyl)propyl]hydrazine |
| SMILES | CCC/N=N/[C@@H](CC)NN(CCC)CCC |
| InChI | InChI=1S/C12H28N4/c1-5-9-13-14-12(8-4)15-16(10-6-2)11-7-3/h12,15H,5-11H2,1-4H3/b14-13+/t12-/m1/s1 |
| InChIKey | OZKYWOIOCNSWGR-VEOJIXDASA-N |
| XLogP | 3.21 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|