C29H36O4 — CID 76764368
(2R,4aS,6aS,6bS,14aS,14bS)-2,4a,6a,6b,9,14a-hexamethyl-10,11-dioxo-3,4,5,6,14,14b-hexahydro-1H-picene-2-carboxylic acid (PubChem CID 76764368) has the molecular formula C29H36O4 and a molecular weight of 448.60 g/mol. Its IUPAC name is (2R,4aS,6aS,6bS,14aS,14bS)-2,4a,6a,6b,9,14a-hexamethyl-10,11-dioxo-3,4,5,6,14,14b-hexahydro-1H-picene-2-carboxylic acid.
| Compound Name | (2R,4aS,6aS,6bS,14aS,14bS)-2,4a,6a,6b,9,14a-hexamethyl-10,11-dioxo-3,4,5,6,14,14b-hexahydro-1H-picene-2-carboxylic acid |
|---|---|
| PubChem CID | 76764368 |
| Molecular Formula | C29H36O4 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | (2R,4aS,6aS,6bS,14aS,14bS)-2,4a,6a,6b,9,14a-hexamethyl-10,11-dioxo-3,4,5,6,14,14b-hexahydro-1H-picene-2-carboxylic acid |
| SMILES | CC1=C2C=C[C@]3(C)C(=CC[C@@]4(C)[C@H]5C[C@](C)(C(=O)O)CC[C@]5(C)CC[C@@]43C)C2=CC(=O)C1=O |
| InChI | InChI=1S/C29H36O4/c1-17-18-7-9-27(4)20(19(18)15-21(30)23(17)31)8-10-28(5)22-16-26(3,24(32)33)12-11-25(22,2)13-14-29(27,28)6/h7-9,15,22H,10-14,16H2,1-6H3,(H,32,33)/t22-,25+,26+,27+,28-,29+/m0/s1 |
| InChIKey | LOQUYCNWTOCMPN-INQIZSKWSA-N |
| XLogP | 5.99 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|