C30H40O4 — CID 15720151
methyl (2R,4aS,6aS,6bS,14aS,14bR)-10,11-dihydroxy-2,4a,6a,6b,9,14a-hexamethyl-3,4,5,6,14,14b-hexahydro-1H-picene-2-carboxylate (PubChem CID 15720151) has the molecular formula C30H40O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is methyl (2R,4aS,6aS,6bS,14aS,14bR)-10,11-dihydroxy-2,4a,6a,6b,9,14a-hexamethyl-3,4,5,6,14,14b-hexahydro-1H-picene-2-carboxylate.
| Compound Name | methyl (2R,4aS,6aS,6bS,14aS,14bR)-10,11-dihydroxy-2,4a,6a,6b,9,14a-hexamethyl-3,4,5,6,14,14b-hexahydro-1H-picene-2-carboxylate |
|---|---|
| PubChem CID | 15720151 |
| Molecular Formula | C30H40O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | methyl (2R,4aS,6aS,6bS,14aS,14bR)-10,11-dihydroxy-2,4a,6a,6b,9,14a-hexamethyl-3,4,5,6,14,14b-hexahydro-1H-picene-2-carboxylate |
| SMILES | COC(=O)[C@]1(C)CC[C@]2(C)CC[C@@]3(C)[C@@](C)(CC=C4c5cc(O)c(O)c(C)c5C=C[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C30H40O4/c1-18-19-8-10-28(4)21(20(19)16-22(31)24(18)32)9-11-29(5)23-17-27(3,25(33)34-7)13-12-26(23,2)14-15-30(28,29)6/h8-10,16,23,31-32H,11-15,17H2,1-7H3/t23-,26-,27-,28-,29+,30-/m1/s1 |
| InChIKey | ZNQFUVKAKSTVGH-ANSCHSPDSA-N |
| XLogP | 7.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|