C30H40O5 — CID 10928927
methyl (2R,4aS,6aR,6aS,9S,14aS,14bR)-9-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-10,11-dioxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate (PubChem CID 10928927) has the molecular formula C30H40O5 and a molecular weight of 480.65 g/mol. Its IUPAC name is methyl (2R,4aS,6aR,6aS,9S,14aS,14bR)-9-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-10,11-dioxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate.
| Compound Name | methyl (2R,4aS,6aR,6aS,9S,14aS,14bR)-9-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-10,11-dioxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate |
|---|---|
| PubChem CID | 10928927 |
| Molecular Formula | C30H40O5 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | methyl (2R,4aS,6aR,6aS,9S,14aS,14bR)-9-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-10,11-dioxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate |
| SMILES | COC(=O)[C@]1(C)CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(=O)[C@@]5(C)O)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C30H40O5/c1-25-10-11-26(2,24(33)35-7)17-22(25)29(5)15-13-27(3)19-16-20(31)23(32)30(6,34)18(19)8-9-21(27)28(29,4)14-12-25/h8-9,16,22,34H,10-15,17H2,1-7H3/t22-,25-,26-,27+,28-,29+,30+/m1/s1 |
| InChIKey | CKUQWAJYIKWVEW-SRYSVAFQSA-N |
| XLogP | 5.27 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|