C31H42O5 — CID 162820546
methyl (2S,4R,4aR,6aR,6aS,14aS,14bS)-4,10-dihydroxy-2,4,4a,6a,6a,9,14a-heptamethyl-11-oxo-3,5,6,13,14,14b-hexahydro-1H-picene-2-carboxylate (PubChem CID 162820546) has the molecular formula C31H42O5 and a molecular weight of 494.67 g/mol. Its IUPAC name is methyl (2S,4R,4aR,6aR,6aS,14aS,14bS)-4,10-dihydroxy-2,4,4a,6a,6a,9,14a-heptamethyl-11-oxo-3,5,6,13,14,14b-hexahydro-1H-picene-2-carboxylate.
| Compound Name | methyl (2S,4R,4aR,6aR,6aS,14aS,14bS)-4,10-dihydroxy-2,4,4a,6a,6a,9,14a-heptamethyl-11-oxo-3,5,6,13,14,14b-hexahydro-1H-picene-2-carboxylate |
|---|---|
| PubChem CID | 162820546 |
| Molecular Formula | C31H42O5 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | methyl (2S,4R,4aR,6aR,6aS,14aS,14bS)-4,10-dihydroxy-2,4,4a,6a,6a,9,14a-heptamethyl-11-oxo-3,5,6,13,14,14b-hexahydro-1H-picene-2-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C[C@H]2[C@]3(C)CC[C@@]4(C)C5=CC(=O)C(O)=C(C)C5=CC=C4[C@@]3(C)CC[C@@]2(C)[C@](C)(O)C1 |
| InChI | InChI=1S/C31H42O5/c1-18-19-9-10-22-27(3,20(19)15-21(32)24(18)33)11-12-29(5)23-16-26(2,25(34)36-8)17-31(7,35)30(23,6)14-13-28(22,29)4/h9-10,15,23,33,35H,11-14,16-17H2,1-8H3/t23-,26-,27-,28+,29-,30+,31+/m0/s1 |
| InChIKey | MHNISCKQPOFKLG-IFUWMICHSA-N |
| XLogP | 6.15 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |