C30H40O4 — CID 163642757
(2R,4aS,6aR,6aS,14aS,14bS)-10-hydroxy-2,4,4a,6a,6a,9,14a-heptamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylic acid (PubChem CID 163642757) has the molecular formula C30H40O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is (2R,4aS,6aR,6aS,14aS,14bS)-10-hydroxy-2,4,4a,6a,6a,9,14a-heptamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylic acid.
| Compound Name | (2R,4aS,6aR,6aS,14aS,14bS)-10-hydroxy-2,4,4a,6a,6a,9,14a-heptamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylic acid |
|---|---|
| PubChem CID | 163642757 |
| Molecular Formula | C30H40O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | (2R,4aS,6aR,6aS,14aS,14bS)-10-hydroxy-2,4,4a,6a,6a,9,14a-heptamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylic acid |
| SMILES | CC1=C(O)C(=O)C=C2C1=CC=C1[C@@]2(C)CC[C@@]2(C)[C@H]3C[C@](C)(C(=O)O)CC(C)[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C30H40O4/c1-17-15-26(3,25(33)34)16-23-27(17,4)10-12-29(6)22-9-8-19-18(2)24(32)21(31)14-20(19)28(22,5)11-13-30(23,29)7/h8-9,14,17,23,32H,10-13,15-16H2,1-7H3,(H,33,34)/t17?,23-,26+,27-,28-,29+,30-/m0/s1 |
| InChIKey | IFRCVHHWRZZOFS-NUVYVUPHSA-N |
| XLogP | 6.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |