C32H42O6 — CID 59428287
(2-methoxy-2-oxoethyl) (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate (PubChem CID 59428287) has the molecular formula C32H42O6 and a molecular weight of 522.68 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate.
| Compound Name | (2-methoxy-2-oxoethyl) (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate |
|---|---|
| PubChem CID | 59428287 |
| Molecular Formula | C32H42O6 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | (2-methoxy-2-oxoethyl) (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate |
| SMILES | COC(=O)COC(=O)[C@]1(C)CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C32H42O6/c1-19-20-8-9-23-30(4,21(20)16-22(33)26(19)35)13-15-32(6)24-17-29(3,27(36)38-18-25(34)37-7)11-10-28(24,2)12-14-31(23,32)5/h8-9,16,24,35H,10-15,17-18H2,1-7H3/t24-,28-,29-,30+,31-,32+/m1/s1 |
| InChIKey | INHUILMVLIXIOP-LLYXLEJJSA-N |
| XLogP | 6.33 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |