C30H41NO4 — CID 118570856
[(2R,4aR,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]methyl carbamate (PubChem CID 118570856) has the molecular formula C30H41NO4 and a molecular weight of 479.66 g/mol. Its IUPAC name is [(2R,4aR,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]methyl carbamate.
| Compound Name | [(2R,4aR,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]methyl carbamate |
|---|---|
| PubChem CID | 118570856 |
| Molecular Formula | C30H41NO4 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | [(2R,4aR,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]methyl carbamate |
| SMILES | CC1=C(O)C(=O)C=C2C1=CC=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(COC(N)=O)CC[C@@]3(C)CC[C@]12C |
| InChI | InChI=1S/C30H41NO4/c1-18-19-7-8-22-28(4,20(19)15-21(32)24(18)33)12-14-30(6)23-16-26(2,17-35-25(31)34)9-10-27(23,3)11-13-29(22,30)5/h7-8,15,23,33H,9-14,16-17H2,1-6H3,(H2,31,34)/t23-,26-,27+,28+,29-,30+/m1/s1 |
| InChIKey | AAHIWMNZZCDLGT-ZAZHENERSA-N |
| XLogP | 6.71 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |