C35H50N2O5 — CID 118570898
[(2R,4aR,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]methyl 4-amino-2-(dimethylamino)-4-oxobutanoate (PubChem CID 118570898) has the molecular formula C35H50N2O5 and a molecular weight of 578.79 g/mol. Its IUPAC name is [(2R,4aR,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]methyl 4-amino-2-(dimethylamino)-4-oxobutanoate.
| Compound Name | [(2R,4aR,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]methyl 4-amino-2-(dimethylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 118570898 |
| Molecular Formula | C35H50N2O5 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.37 |
| IUPAC Name | [(2R,4aR,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]methyl 4-amino-2-(dimethylamino)-4-oxobutanoate |
| SMILES | CC1=C(O)C(=O)C=C2C1=CC=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(COC(=O)C(CC(N)=O)N(C)C)CC[C@@]3(C)CC[C@]12C |
| InChI | InChI=1S/C35H50N2O5/c1-21-22-9-10-26-33(4,23(22)17-25(38)29(21)40)14-16-35(6)27-19-31(2,11-12-32(27,3)13-15-34(26,35)5)20-42-30(41)24(37(7)8)18-28(36)39/h9-10,17,24,27,40H,11-16,18-20H2,1-8H3,(H2,36,39)/t24?,27-,31-,32+,33+,34-,35+/m1/s1 |
| InChIKey | RDQPENRIFWAIDO-NYXIFEPFSA-N |
| XLogP | 5.96 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |