C32H47NO3 — CID 146610449
(6aS,6bS,8aS,11R,12aR,14aR)-3-hydroxy-11-[[1-hydroxyethyl(methyl)amino]methyl]-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one (PubChem CID 146610449) has the molecular formula C32H47NO3 and a molecular weight of 493.73 g/mol. Its IUPAC name is (6aS,6bS,8aS,11R,12aR,14aR)-3-hydroxy-11-[[1-hydroxyethyl(methyl)amino]methyl]-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one.
| Compound Name | (6aS,6bS,8aS,11R,12aR,14aR)-3-hydroxy-11-[[1-hydroxyethyl(methyl)amino]methyl]-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one |
|---|---|
| PubChem CID | 146610449 |
| Molecular Formula | C32H47NO3 |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 493.36 |
| IUPAC Name | (6aS,6bS,8aS,11R,12aR,14aR)-3-hydroxy-11-[[1-hydroxyethyl(methyl)amino]methyl]-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one |
| SMILES | CC1=C(O)C(=O)C=C2C1=CC=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(CN(C)C(C)O)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C32H47NO3/c1-20-22-9-10-25-30(5,23(22)17-24(35)27(20)36)14-16-32(7)26-18-28(3,19-33(8)21(2)34)11-12-29(26,4)13-15-31(25,32)6/h9-10,17,21,26,34,36H,11-16,18-19H2,1-8H3/t21?,26-,28-,29-,30+,31-,32+/m1/s1 |
| InChIKey | OMOFSHAMYMVDLO-BYKJSKJQSA-N |
| XLogP | 6.88 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|