C32H47NO2 — CID 146609988
(6aS,6bS,8aS,11R,12aR,14aR)-11-[(dimethylamino)methyl]-6a-ethyl-3-hydroxy-4,6b,8a,11,14a-pentamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one (PubChem CID 146609988) has the molecular formula C32H47NO2 and a molecular weight of 477.73 g/mol. Its IUPAC name is (6aS,6bS,8aS,11R,12aR,14aR)-11-[(dimethylamino)methyl]-6a-ethyl-3-hydroxy-4,6b,8a,11,14a-pentamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one.
| Compound Name | (6aS,6bS,8aS,11R,12aR,14aR)-11-[(dimethylamino)methyl]-6a-ethyl-3-hydroxy-4,6b,8a,11,14a-pentamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one |
|---|---|
| PubChem CID | 146609988 |
| Molecular Formula | C32H47NO2 |
| Molecular Weight | 477.73 g/mol |
| Exact Mass | 477.36 |
| IUPAC Name | (6aS,6bS,8aS,11R,12aR,14aR)-11-[(dimethylamino)methyl]-6a-ethyl-3-hydroxy-4,6b,8a,11,14a-pentamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one |
| SMILES | CC[C@@]12CC[C@@]3(C)C4=CC(=O)C(O)=C(C)C4=CC=C3[C@@]1(C)CC[C@@]1(C)CC[C@@](C)(CN(C)C)C[C@H]12 |
| InChI | InChI=1S/C32H47NO2/c1-9-32-17-15-30(5)23-18-24(34)27(35)21(2)22(23)10-11-25(30)31(32,6)16-14-29(4)13-12-28(3,19-26(29)32)20-33(7)8/h10-11,18,26,35H,9,12-17,19-20H2,1-8H3/t26-,28-,29-,30+,31-,32+/m1/s1 |
| InChIKey | YABAFNGJEOFQOI-JJPWUKMOSA-N |
| XLogP | 7.56 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.73 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |