C30H43NO4S — CID 146610466
N-[(2R,4aS,6aR,6aS,14aS,14bR)-14a-ethyl-10-hydroxy-2,4a,6a,6a,9-pentamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]methanesulfonamide (PubChem CID 146610466) has the molecular formula C30H43NO4S and a molecular weight of 513.74 g/mol. Its IUPAC name is N-[(2R,4aS,6aR,6aS,14aS,14bR)-14a-ethyl-10-hydroxy-2,4a,6a,6a,9-pentamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]methanesulfonamide.
| Compound Name | N-[(2R,4aS,6aR,6aS,14aS,14bR)-14a-ethyl-10-hydroxy-2,4a,6a,6a,9-pentamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 146610466 |
| Molecular Formula | C30H43NO4S |
| Molecular Weight | 513.74 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | N-[(2R,4aS,6aR,6aS,14aS,14bR)-14a-ethyl-10-hydroxy-2,4a,6a,6a,9-pentamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]methanesulfonamide |
| SMILES | CC[C@@]12CC[C@@]3(C)C4=CC(=O)C(O)=C(C)C4=CC=C3[C@@]1(C)CC[C@@]1(C)CC[C@@](C)(NS(C)(=O)=O)C[C@H]12 |
| InChI | InChI=1S/C30H43NO4S/c1-8-30-16-14-28(5)21-17-22(32)25(33)19(2)20(21)9-10-23(28)29(30,6)15-12-26(3)11-13-27(4,18-24(26)30)31-36(7,34)35/h9-10,17,24,31,33H,8,11-16,18H2,1-7H3/t24-,26-,27-,28+,29-,30+/m1/s1 |
| InChIKey | KTKUOBJWOYODNM-AZUGTCGHSA-N |
| XLogP | 6.30 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.74 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |