C32H45NO4 — CID 146609696
ethyl N-[(2R,4aS,6aR,6aS,14aS,14bR)-14a-ethyl-10-hydroxy-2,4a,6a,6a,9-pentamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]carbamate (PubChem CID 146609696) has the molecular formula C32H45NO4 and a molecular weight of 507.72 g/mol. Its IUPAC name is ethyl N-[(2R,4aS,6aR,6aS,14aS,14bR)-14a-ethyl-10-hydroxy-2,4a,6a,6a,9-pentamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]carbamate.
| Compound Name | ethyl N-[(2R,4aS,6aR,6aS,14aS,14bR)-14a-ethyl-10-hydroxy-2,4a,6a,6a,9-pentamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]carbamate |
|---|---|
| PubChem CID | 146609696 |
| Molecular Formula | C32H45NO4 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.33 |
| IUPAC Name | ethyl N-[(2R,4aS,6aR,6aS,14aS,14bR)-14a-ethyl-10-hydroxy-2,4a,6a,6a,9-pentamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]carbamate |
| SMILES | CCOC(=O)N[C@]1(C)CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)[C@]4(C)CC[C@@]3(CC)[C@@H]2C1 |
| InChI | InChI=1S/C32H45NO4/c1-8-32-17-15-30(6)22-18-23(34)26(35)20(3)21(22)10-11-24(30)31(32,7)16-13-28(4)12-14-29(5,19-25(28)32)33-27(36)37-9-2/h10-11,18,25,35H,8-9,12-17,19H2,1-7H3,(H,33,36)/t25-,28-,29-,30+,31-,32+/m1/s1 |
| InChIKey | RZUUFVLPZVTNEP-JSJVQHDDSA-N |
| XLogP | 7.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |