C36H49N3O4 — CID 170730108
N-[(14aS)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]-2-[(1R,5S)-6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl]-2-oxoacetamide (PubChem CID 170730108) has the molecular formula C36H49N3O4 and a molecular weight of 587.81 g/mol. Its IUPAC name is N-[(14aS)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]-2-[(1R,5S)-6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl]-2-oxoacetamide.
| Compound Name | N-[(14aS)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]-2-[(1R,5S)-6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 170730108 |
| Molecular Formula | C36H49N3O4 |
| Molecular Weight | 587.81 g/mol |
| Exact Mass | 587.37 |
| IUPAC Name | N-[(14aS)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]-2-[(1R,5S)-6-methyl-3,6-diazabicyclo[3.1.1]heptan-3-yl]-2-oxoacetamide |
| SMILES | CC1=C(O)C(=O)C=C2C1=CC=C1C2(C)CC[C@@]2(C)C3CC(C)(NC(=O)C(=O)N4C[C@H]5C[C@@H](C4)N5C)CCC3(C)CCC12C |
| InChI | InChI=1S/C36H49N3O4/c1-21-24-8-9-27-34(4,25(24)17-26(40)29(21)41)13-15-36(6)28-18-33(3,12-10-32(28,2)11-14-35(27,36)5)37-30(42)31(43)39-19-22-16-23(20-39)38(22)7/h8-9,17,22-23,28,41H,10-16,18-20H2,1-7H3,(H,37,42)/t22-,23+,28?,32?,33?,34?,35?,36-/m0/s1 |
| InChIKey | NIOPGBCGIUHJTC-BACNVPDZSA-N |
| XLogP | 5.40 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.81 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|