C35H50N2O5S — CID 177383088
methyl (2S)-2-[[(2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]carbamoylamino]-4-methylsulfanylbutanoate (PubChem CID 177383088) has the molecular formula C35H50N2O5S and a molecular weight of 610.86 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]carbamoylamino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[[(2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]carbamoylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 177383088 |
| Molecular Formula | C35H50N2O5S |
| Molecular Weight | 610.86 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | methyl (2S)-2-[[(2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]carbamoylamino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)N[C@]1(C)CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C35H50N2O5S/c1-21-22-9-10-26-33(4,23(22)19-25(38)28(21)39)15-17-35(6)27-20-32(3,14-12-31(27,2)13-16-34(26,35)5)37-30(41)36-24(11-18-43-8)29(40)42-7/h9-10,19,24,27,39H,11-18,20H2,1-8H3,(H2,36,37,41)/t24-,27+,31+,32+,33-,34+,35-/m0/s1 |
| InChIKey | DTUZFABUECNHLW-HWIGTIQTSA-N |
| XLogP | 6.96 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.86 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |