C33H48N2O5 — CID 166449406
methyl (2S)-2-[[(2R,4aS,6aS,6aS,9R,14aS,14bR)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,9,13,14,14b-octahydro-1H-picen-2-yl]carbamoylamino]propanoate (PubChem CID 166449406) has the molecular formula C33H48N2O5 and a molecular weight of 552.76 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R,4aS,6aS,6aS,9R,14aS,14bR)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,9,13,14,14b-octahydro-1H-picen-2-yl]carbamoylamino]propanoate.
| Compound Name | methyl (2S)-2-[[(2R,4aS,6aS,6aS,9R,14aS,14bR)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,9,13,14,14b-octahydro-1H-picen-2-yl]carbamoylamino]propanoate |
|---|---|
| PubChem CID | 166449406 |
| Molecular Formula | C33H48N2O5 |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.36 |
| IUPAC Name | methyl (2S)-2-[[(2R,4aS,6aS,6aS,9R,14aS,14bR)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,9,13,14,14b-octahydro-1H-picen-2-yl]carbamoylamino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)N[C@]1(C)CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(O)=C(O)[C@@H]5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C33H48N2O5/c1-19-21-9-10-24-31(5,22(21)17-23(36)26(19)37)14-16-33(7)25-18-30(4,35-28(39)34-20(2)27(38)40-8)13-11-29(25,3)12-15-32(24,33)6/h9-10,17,19-20,25,36-37H,11-16,18H2,1-8H3,(H2,34,35,39)/t19-,20+,25-,29-,30-,31+,32-,33+/m1/s1 |
| InChIKey | PHLJXAGVBMDBNR-LWEMQXMQSA-N |
| XLogP | 6.79 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |