C28H36O5 — CID 14707060
methyl 1,11,14,17,20-pentamethyl-6,8-dioxo-7-oxapentacyclo[12.8.0.02,11.05,10.015,20]docosa-2,4,9-triene-17-carboxylate (PubChem CID 14707060) has the molecular formula C28H36O5 and a molecular weight of 452.59 g/mol. Its IUPAC name is methyl 1,11,14,17,20-pentamethyl-6,8-dioxo-7-oxapentacyclo[12.8.0.02,11.05,10.015,20]docosa-2,4,9-triene-17-carboxylate.
| Compound Name | methyl 1,11,14,17,20-pentamethyl-6,8-dioxo-7-oxapentacyclo[12.8.0.02,11.05,10.015,20]docosa-2,4,9-triene-17-carboxylate |
|---|---|
| PubChem CID | 14707060 |
| Molecular Formula | C28H36O5 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | methyl 1,11,14,17,20-pentamethyl-6,8-dioxo-7-oxapentacyclo[12.8.0.02,11.05,10.015,20]docosa-2,4,9-triene-17-carboxylate |
| SMILES | COC(=O)C1(C)CCC2(C)CCC3(C)C4=CC=C5C(=O)OC(=O)C=C5C4(C)CCC3(C)C2C1 |
| InChI | InChI=1S/C28H36O5/c1-24-9-10-25(2,23(31)32-6)16-20(24)28(5)14-12-26(3)18-15-21(29)33-22(30)17(18)7-8-19(26)27(28,4)13-11-24/h7-8,15,20H,9-14,16H2,1-6H3 |
| InChIKey | AFYNUVCDKLFCAU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|