C31H40O4 — CID 118404334
[(6aS,6bS,8aS,11R,12aR,14aR)-11-acetyl-4,6a,6b,8a,11,14a-hexamethyl-2-oxo-7,8,9,10,12,12a,13,14-octahydropicen-3-yl] formate (PubChem CID 118404334) has the molecular formula C31H40O4 and a molecular weight of 476.66 g/mol. Its IUPAC name is [(6aS,6bS,8aS,11R,12aR,14aR)-11-acetyl-4,6a,6b,8a,11,14a-hexamethyl-2-oxo-7,8,9,10,12,12a,13,14-octahydropicen-3-yl] formate.
| Compound Name | [(6aS,6bS,8aS,11R,12aR,14aR)-11-acetyl-4,6a,6b,8a,11,14a-hexamethyl-2-oxo-7,8,9,10,12,12a,13,14-octahydropicen-3-yl] formate |
|---|---|
| PubChem CID | 118404334 |
| Molecular Formula | C31H40O4 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | [(6aS,6bS,8aS,11R,12aR,14aR)-11-acetyl-4,6a,6b,8a,11,14a-hexamethyl-2-oxo-7,8,9,10,12,12a,13,14-octahydropicen-3-yl] formate |
| SMILES | CC(=O)[C@]1(C)CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(OC=O)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C31H40O4/c1-19-21-8-9-24-29(5,22(21)16-23(34)26(19)35-18-32)13-15-31(7)25-17-28(4,20(2)33)11-10-27(25,3)12-14-30(24,31)6/h8-9,16,18,25H,10-15,17H2,1-7H3/t25-,27-,28-,29+,30-,31+/m1/s1 |
| InChIKey | LNYXAQRGNFQEHO-WYUYVVTISA-N |
| XLogP | 6.82 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|