C35H49NO2 — CID 129067607
(6aS,6bS,8aS,11R,12aR,14aR)-11-(1-aminoethenyl)-4,6a,6b,8a,11,14a-hexamethyl-3-(3-methylbut-2-enoxy)-7,8,9,10,12,12a,13,14-octahydropicen-2-one (PubChem CID 129067607) has the molecular formula C35H49NO2 and a molecular weight of 515.78 g/mol. Its IUPAC name is (6aS,6bS,8aS,11R,12aR,14aR)-11-(1-aminoethenyl)-4,6a,6b,8a,11,14a-hexamethyl-3-(3-methylbut-2-enoxy)-7,8,9,10,12,12a,13,14-octahydropicen-2-one.
| Compound Name | (6aS,6bS,8aS,11R,12aR,14aR)-11-(1-aminoethenyl)-4,6a,6b,8a,11,14a-hexamethyl-3-(3-methylbut-2-enoxy)-7,8,9,10,12,12a,13,14-octahydropicen-2-one |
|---|---|
| PubChem CID | 129067607 |
| Molecular Formula | C35H49NO2 |
| Molecular Weight | 515.78 g/mol |
| Exact Mass | 515.38 |
| IUPAC Name | (6aS,6bS,8aS,11R,12aR,14aR)-11-(1-aminoethenyl)-4,6a,6b,8a,11,14a-hexamethyl-3-(3-methylbut-2-enoxy)-7,8,9,10,12,12a,13,14-octahydropicen-2-one |
| SMILES | C=C(N)[C@]1(C)CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(OCC=C(C)C)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C35H49NO2/c1-22(2)12-19-38-30-23(3)25-10-11-28-33(7,26(25)20-27(30)37)16-18-35(9)29-21-32(6,24(4)36)14-13-31(29,5)15-17-34(28,35)8/h10-12,20,29H,4,13-19,21,36H2,1-3,5-9H3/t29-,31-,32-,33+,34-,35+/m1/s1 |
| InChIKey | ZMSXZWQIIUJSSV-LUKWPKLOSA-N |
| XLogP | 8.51 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.78 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|