C31H41NO2 — CID 146609981
(2R,4aS,6aR,14aS,14bR)-10-ethoxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carbonitrile (PubChem CID 146609981) has the molecular formula C31H41NO2 and a molecular weight of 459.67 g/mol. Its IUPAC name is (2R,4aS,6aR,14aS,14bR)-10-ethoxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carbonitrile.
| Compound Name | (2R,4aS,6aR,14aS,14bR)-10-ethoxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 146609981 |
| Molecular Formula | C31H41NO2 |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | (2R,4aS,6aR,14aS,14bR)-10-ethoxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carbonitrile |
| SMILES | CCOC1=C(C)C2=CC=C3C4(C)CC[C@@]5(C)CC[C@@](C)(C#N)C[C@H]5[C@]4(C)CC[C@@]3(C)C2=CC1=O |
| InChI | InChI=1S/C31H41NO2/c1-8-34-26-20(2)21-9-10-24-29(5,22(21)17-23(26)33)14-16-31(7)25-18-27(3,19-32)11-12-28(25,4)13-15-30(24,31)6/h9-10,17,25H,8,11-16,18H2,1-7H3/t25-,27-,28-,29+,30?,31+/m1/s1 |
| InChIKey | KHEAYPTZBBWHFF-SDIDFGHPSA-N |
| XLogP | 7.62 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |