C38H48O4 — CID 145300928
ethyl (2R,4aS,6aR,6aS,14aS,14bR)-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-10-phenylmethoxy-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate (PubChem CID 145300928) has the molecular formula C38H48O4 and a molecular weight of 568.80 g/mol. Its IUPAC name is ethyl (2R,4aS,6aR,6aS,14aS,14bR)-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-10-phenylmethoxy-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate.
| Compound Name | ethyl (2R,4aS,6aR,6aS,14aS,14bR)-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-10-phenylmethoxy-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate |
|---|---|
| PubChem CID | 145300928 |
| Molecular Formula | C38H48O4 |
| Molecular Weight | 568.80 g/mol |
| Exact Mass | 568.36 |
| IUPAC Name | ethyl (2R,4aS,6aR,6aS,14aS,14bR)-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-10-phenylmethoxy-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(OCc6ccccc6)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C38H48O4/c1-8-41-33(40)35(4)17-16-34(3)18-20-37(6)30-15-14-27-25(2)32(42-24-26-12-10-9-11-13-26)29(39)22-28(27)36(30,5)19-21-38(37,7)31(34)23-35/h9-15,22,31H,8,16-21,23-24H2,1-7H3/t31-,34-,35-,36+,37-,38+/m1/s1 |
| InChIKey | KWFSPFBYSPIUHL-YUPZTJLBSA-N |
| XLogP | 8.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.80 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |