C32H42N2O3 — CID 129067331
[(6aS,6bS,8aS,11R,12aR,14aR)-11-cyano-4,6a,6b,8a,11,14a-hexamethyl-2-oxo-7,8,9,10,12,12a,13,14-octahydropicen-3-yl] N-ethylcarbamate (PubChem CID 129067331) has the molecular formula C32H42N2O3 and a molecular weight of 502.70 g/mol. Its IUPAC name is [(6aS,6bS,8aS,11R,12aR,14aR)-11-cyano-4,6a,6b,8a,11,14a-hexamethyl-2-oxo-7,8,9,10,12,12a,13,14-octahydropicen-3-yl] N-ethylcarbamate.
| Compound Name | [(6aS,6bS,8aS,11R,12aR,14aR)-11-cyano-4,6a,6b,8a,11,14a-hexamethyl-2-oxo-7,8,9,10,12,12a,13,14-octahydropicen-3-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 129067331 |
| Molecular Formula | C32H42N2O3 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.32 |
| IUPAC Name | [(6aS,6bS,8aS,11R,12aR,14aR)-11-cyano-4,6a,6b,8a,11,14a-hexamethyl-2-oxo-7,8,9,10,12,12a,13,14-octahydropicen-3-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)OC1=C(C)C2=CC=C3[C@@](C)(CC[C@@]4(C)[C@@H]5C[C@](C)(C#N)CC[C@]5(C)CC[C@]34C)C2=CC1=O |
| InChI | InChI=1S/C32H42N2O3/c1-8-34-27(36)37-26-20(2)21-9-10-24-30(5,22(21)17-23(26)35)14-16-32(7)25-18-28(3,19-33)11-12-29(25,4)13-15-31(24,32)6/h9-10,17,25H,8,11-16,18H2,1-7H3,(H,34,36)/t25-,28-,29-,30+,31-,32+/m1/s1 |
| InChIKey | QDJSZYXICHVZKS-JSJVQHDDSA-N |
| XLogP | 7.32 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |