C33H45NO5 — CID 24996118
methyl 10-(dimethylcarbamoyloxy)-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate (PubChem CID 24996118) has the molecular formula C33H45NO5 and a molecular weight of 535.73 g/mol. Its IUPAC name is methyl 10-(dimethylcarbamoyloxy)-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate.
| Compound Name | methyl 10-(dimethylcarbamoyloxy)-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate |
|---|---|
| PubChem CID | 24996118 |
| Molecular Formula | C33H45NO5 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | methyl 10-(dimethylcarbamoyloxy)-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate |
| SMILES | COC(=O)C1(C)CCC2(C)CCC3(C)C4=CC=C5C(=CC(=O)C(OC(=O)N(C)C)=C5C)C4(C)CCC3(C)C2C1 |
| InChI | InChI=1S/C33H45NO5/c1-20-21-10-11-24-31(4,22(21)18-23(35)26(20)39-28(37)34(7)8)15-17-33(6)25-19-30(3,27(36)38-9)13-12-29(25,2)14-16-32(24,33)5/h10-11,18,25H,12-17,19H2,1-9H3 |
| InChIKey | BCHDKANHNVHEMT-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |