C29H40O3 — CID 132989081
(6aS,6bS,8aR,11R,12aR,14aR)-3-hydroxy-11-(hydroxymethyl)-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one (PubChem CID 132989081) has the molecular formula C29H40O3 and a molecular weight of 436.64 g/mol. Its IUPAC name is (6aS,6bS,8aR,11R,12aR,14aR)-3-hydroxy-11-(hydroxymethyl)-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one.
| Compound Name | (6aS,6bS,8aR,11R,12aR,14aR)-3-hydroxy-11-(hydroxymethyl)-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one |
|---|---|
| PubChem CID | 132989081 |
| Molecular Formula | C29H40O3 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | (6aS,6bS,8aR,11R,12aR,14aR)-3-hydroxy-11-(hydroxymethyl)-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one |
| SMILES | CC1=C(O)C(=O)C=C2C1=CC=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(CO)CC[C@@]3(C)CC[C@]12C |
| InChI | InChI=1S/C29H40O3/c1-18-19-7-8-22-27(4,20(19)15-21(31)24(18)32)12-14-29(6)23-16-25(2,17-30)9-10-26(23,3)11-13-28(22,29)5/h7-8,15,23,30,32H,9-14,16-17H2,1-6H3/t23-,25-,26+,27+,28-,29+/m1/s1 |
| InChIKey | GYUVZGGERRSPQY-PKRYXMRBSA-N |
| XLogP | 6.61 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |