C33H47NO3 — CID 170196358
N-[[(2R,4aS,6aR,6aS,14aS,14bR)-14a-ethyl-10-hydroxy-2,4a,6a,6a,9-pentamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]methyl]-N-methylacetamide (PubChem CID 170196358) has the molecular formula C33H47NO3 and a molecular weight of 505.74 g/mol. Its IUPAC name is N-[[(2R,4aS,6aR,6aS,14aS,14bR)-14a-ethyl-10-hydroxy-2,4a,6a,6a,9-pentamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]methyl]-N-methylacetamide.
| Compound Name | N-[[(2R,4aS,6aR,6aS,14aS,14bR)-14a-ethyl-10-hydroxy-2,4a,6a,6a,9-pentamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 170196358 |
| Molecular Formula | C33H47NO3 |
| Molecular Weight | 505.74 g/mol |
| Exact Mass | 505.36 |
| IUPAC Name | N-[[(2R,4aS,6aR,6aS,14aS,14bR)-14a-ethyl-10-hydroxy-2,4a,6a,6a,9-pentamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]methyl]-N-methylacetamide |
| SMILES | CC[C@@]12CC[C@@]3(C)C4=CC(=O)C(O)=C(C)C4=CC=C3[C@@]1(C)CC[C@@]1(C)CC[C@@](C)(CN(C)C(C)=O)C[C@H]12 |
| InChI | InChI=1S/C33H47NO3/c1-9-33-17-15-31(6)24-18-25(36)28(37)21(2)23(24)10-11-26(31)32(33,7)16-14-30(5)13-12-29(4,19-27(30)33)20-34(8)22(3)35/h10-11,18,27,37H,9,12-17,19-20H2,1-8H3/t27-,29-,30-,31+,32-,33+/m1/s1 |
| InChIKey | OUWZHVGEEVEBAH-ANCVDJAISA-N |
| XLogP | 7.48 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.74 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |