C34H47N3O4 — CID 166949134
(2R,4aS,6aR,6aS,14aS)-4-(4-azido-2-methylbutyl)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylic acid (PubChem CID 166949134) has the molecular formula C34H47N3O4 and a molecular weight of 561.77 g/mol. Its IUPAC name is (2R,4aS,6aR,6aS,14aS)-4-(4-azido-2-methylbutyl)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylic acid.
| Compound Name | (2R,4aS,6aR,6aS,14aS)-4-(4-azido-2-methylbutyl)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylic acid |
|---|---|
| PubChem CID | 166949134 |
| Molecular Formula | C34H47N3O4 |
| Molecular Weight | 561.77 g/mol |
| Exact Mass | 561.36 |
| IUPAC Name | (2R,4aS,6aR,6aS,14aS)-4-(4-azido-2-methylbutyl)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylic acid |
| SMILES | CC1=C(O)C(=O)C=C2C1=CC=C1[C@@]2(C)CC[C@@]2(C)C3C[C@](C)(C(=O)O)CC(CC(C)CCN=[N+]=[N-])[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C34H47N3O4/c1-20(10-15-36-37-35)16-22-18-30(3,29(40)41)19-27-31(22,4)11-13-33(6)26-9-8-23-21(2)28(39)25(38)17-24(23)32(26,5)12-14-34(27,33)7/h8-9,17,20,22,27,39H,10-16,18-19H2,1-7H3,(H,40,41)/t20?,22?,27?,30-,31+,32+,33-,34+/m1/s1 |
| InChIKey | ACPVKMSMTGUWOX-DUXVAHDPSA-N |
| XLogP | 8.65 |
| TPSA | 123.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.77 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|