C29H41NO3 — CID 165387047
(4R,6aS,6bS,8aS,11R,12aR,14aR)-11-amino-4-(hydroxymethyl)-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicene-2,3-dione (PubChem CID 165387047) has the molecular formula C29H41NO3 and a molecular weight of 451.65 g/mol. Its IUPAC name is (4R,6aS,6bS,8aS,11R,12aR,14aR)-11-amino-4-(hydroxymethyl)-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicene-2,3-dione.
| Compound Name | (4R,6aS,6bS,8aS,11R,12aR,14aR)-11-amino-4-(hydroxymethyl)-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicene-2,3-dione |
|---|---|
| PubChem CID | 165387047 |
| Molecular Formula | C29H41NO3 |
| Molecular Weight | 451.65 g/mol |
| Exact Mass | 451.31 |
| IUPAC Name | (4R,6aS,6bS,8aS,11R,12aR,14aR)-11-amino-4-(hydroxymethyl)-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicene-2,3-dione |
| SMILES | C[C@@]1(N)CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(=O)[C@@]5(C)CO)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C29H41NO3/c1-24-9-11-25(2,30)16-22(24)29(6)14-12-26(3)19-15-20(32)23(33)27(4,17-31)18(19)7-8-21(26)28(29,5)13-10-24/h7-8,15,22,31H,9-14,16-17,30H2,1-6H3/t22-,24-,25-,26+,27+,28-,29+/m1/s1 |
| InChIKey | YKNRSHZMIZFVED-WWHRLTNXSA-N |
| XLogP | 5.06 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.65 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|