C30H43NO4 — CID 165387067
(2R,4aS,6aR,6aS,9R,10R,14aS,14bR)-10-hydroxy-9-(hydroxymethyl)-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-3,4,5,6,10,13,14,14b-octahydro-1H-picene-2-carboxamide (PubChem CID 165387067) has the molecular formula C30H43NO4 and a molecular weight of 481.68 g/mol. Its IUPAC name is (2R,4aS,6aR,6aS,9R,10R,14aS,14bR)-10-hydroxy-9-(hydroxymethyl)-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-3,4,5,6,10,13,14,14b-octahydro-1H-picene-2-carboxamide.
| Compound Name | (2R,4aS,6aR,6aS,9R,10R,14aS,14bR)-10-hydroxy-9-(hydroxymethyl)-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-3,4,5,6,10,13,14,14b-octahydro-1H-picene-2-carboxamide |
|---|---|
| PubChem CID | 165387067 |
| Molecular Formula | C30H43NO4 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.32 |
| IUPAC Name | (2R,4aS,6aR,6aS,9R,10R,14aS,14bR)-10-hydroxy-9-(hydroxymethyl)-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-3,4,5,6,10,13,14,14b-octahydro-1H-picene-2-carboxamide |
| SMILES | C[C@@]1(C(N)=O)CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)[C@H](O)[C@@]5(C)CO)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C30H43NO4/c1-25-9-10-26(2,24(31)35)16-22(25)30(6)14-12-27(3)19-15-20(33)23(34)28(4,17-32)18(19)7-8-21(27)29(30,5)13-11-25/h7-8,15,22-23,32,34H,9-14,16-17H2,1-6H3,(H2,31,35)/t22-,23+,25-,26-,27+,28+,29-,30+/m1/s1 |
| InChIKey | BEDJGWJSIGPGCP-OCLVQLLVSA-N |
| XLogP | 4.63 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |