C30H42O7S — CID 59546534
(6aS,6bS,8aS,11R,12aR,14aR)-2,3-dihydroxy-11-methoxycarbonyl-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydro-5H-picene-5-sulfonic acid (PubChem CID 59546534) has the molecular formula C30H42O7S and a molecular weight of 546.73 g/mol. Its IUPAC name is (6aS,6bS,8aS,11R,12aR,14aR)-2,3-dihydroxy-11-methoxycarbonyl-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydro-5H-picene-5-sulfonic acid.
| Compound Name | (6aS,6bS,8aS,11R,12aR,14aR)-2,3-dihydroxy-11-methoxycarbonyl-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydro-5H-picene-5-sulfonic acid |
|---|---|
| PubChem CID | 59546534 |
| Molecular Formula | C30H42O7S |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | (6aS,6bS,8aS,11R,12aR,14aR)-2,3-dihydroxy-11-methoxycarbonyl-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydro-5H-picene-5-sulfonic acid |
| SMILES | COC(=O)[C@]1(C)CC[C@]2(C)CC[C@]3(C)C4=CC(S(=O)(=O)O)c5c(cc(O)c(O)c5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C30H42O7S/c1-17-23-18(14-19(31)24(17)32)28(4)11-13-30(6)22-16-27(3,25(33)37-7)9-8-26(22,2)10-12-29(30,5)21(28)15-20(23)38(34,35)36/h14-15,20,22,31-32H,8-13,16H2,1-7H3,(H,34,35,36)/t20?,22-,26-,27-,28+,29-,30+/m1/s1 |
| InChIKey | BFHPZIQUSSATOK-KAEYYXDMSA-N |
| XLogP | 6.12 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|