C32H44O5S — CID 145301075
(2R,4aS,6aR,6aS,14aS,14bR)-8-acetylsulfanyl-10-hydroxy-11-methoxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid (PubChem CID 145301075) has the molecular formula C32H44O5S and a molecular weight of 540.77 g/mol. Its IUPAC name is (2R,4aS,6aR,6aS,14aS,14bR)-8-acetylsulfanyl-10-hydroxy-11-methoxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid.
| Compound Name | (2R,4aS,6aR,6aS,14aS,14bR)-8-acetylsulfanyl-10-hydroxy-11-methoxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid |
|---|---|
| PubChem CID | 145301075 |
| Molecular Formula | C32H44O5S |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | (2R,4aS,6aR,6aS,14aS,14bR)-8-acetylsulfanyl-10-hydroxy-11-methoxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid |
| SMILES | COc1cc2c(c(C)c1O)C(SC(C)=O)C=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(C(=O)O)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C32H44O5S/c1-18-25-20(15-21(37-8)26(18)34)30(5)12-14-32(7)24-17-29(4,27(35)36)10-9-28(24,3)11-13-31(32,6)23(30)16-22(25)38-19(2)33/h15-16,22,24,34H,9-14,17H2,1-8H3,(H,35,36)/t22?,24-,28-,29-,30+,31-,32+/m1/s1 |
| InChIKey | ADFZLVYDKLIHMR-RMQSCLQYSA-N |
| XLogP | 7.73 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|