C37H51NO6S — CID 129067379
[(6aS,6bS,8aS,11R,12aR,14aR)-3-acetyloxy-11-carbamoyl-4,6a,6b,8a,11,14a-hexamethyl-5-(2-methylpropanoylsulfanyl)-7,8,9,10,12,12a,13,14-octahydro-5H-picen-2-yl] acetate (PubChem CID 129067379) has the molecular formula C37H51NO6S and a molecular weight of 637.88 g/mol. Its IUPAC name is [(6aS,6bS,8aS,11R,12aR,14aR)-3-acetyloxy-11-carbamoyl-4,6a,6b,8a,11,14a-hexamethyl-5-(2-methylpropanoylsulfanyl)-7,8,9,10,12,12a,13,14-octahydro-5H-picen-2-yl] acetate.
| Compound Name | [(6aS,6bS,8aS,11R,12aR,14aR)-3-acetyloxy-11-carbamoyl-4,6a,6b,8a,11,14a-hexamethyl-5-(2-methylpropanoylsulfanyl)-7,8,9,10,12,12a,13,14-octahydro-5H-picen-2-yl] acetate |
|---|---|
| PubChem CID | 129067379 |
| Molecular Formula | C37H51NO6S |
| Molecular Weight | 637.88 g/mol |
| Exact Mass | 637.34 |
| IUPAC Name | [(6aS,6bS,8aS,11R,12aR,14aR)-3-acetyloxy-11-carbamoyl-4,6a,6b,8a,11,14a-hexamethyl-5-(2-methylpropanoylsulfanyl)-7,8,9,10,12,12a,13,14-octahydro-5H-picen-2-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(c(C)c1OC(C)=O)C(SC(=O)C(C)C)C=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(C(N)=O)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C37H51NO6S/c1-20(2)31(41)45-26-18-27-35(8,24-17-25(43-22(4)39)30(44-23(5)40)21(3)29(24)26)14-16-37(10)28-19-34(7,32(38)42)12-11-33(28,6)13-15-36(27,37)9/h17-18,20,26,28H,11-16,19H2,1-10H3,(H2,38,42)/t26?,28-,33-,34-,35+,36-,37+/m1/s1 |
| InChIKey | NCYFSEPRBJTINW-CFYZQCLMSA-N |
| XLogP | 7.90 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.88 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|