C38H57NO4S — CID 129067339
[(6aS,6bS,8aS,11R,12aR,14aR)-3-acetyloxy-11-[(dimethylamino)methyl]-4,6a,6b,8a,11,14a-hexamethyl-5-propan-2-ylsulfanyl-7,8,9,10,12,12a,13,14-octahydro-5H-picen-2-yl] acetate (PubChem CID 129067339) has the molecular formula C38H57NO4S and a molecular weight of 623.94 g/mol. Its IUPAC name is [(6aS,6bS,8aS,11R,12aR,14aR)-3-acetyloxy-11-[(dimethylamino)methyl]-4,6a,6b,8a,11,14a-hexamethyl-5-propan-2-ylsulfanyl-7,8,9,10,12,12a,13,14-octahydro-5H-picen-2-yl] acetate.
| Compound Name | [(6aS,6bS,8aS,11R,12aR,14aR)-3-acetyloxy-11-[(dimethylamino)methyl]-4,6a,6b,8a,11,14a-hexamethyl-5-propan-2-ylsulfanyl-7,8,9,10,12,12a,13,14-octahydro-5H-picen-2-yl] acetate |
|---|---|
| PubChem CID | 129067339 |
| Molecular Formula | C38H57NO4S |
| Molecular Weight | 623.94 g/mol |
| Exact Mass | 623.40 |
| IUPAC Name | [(6aS,6bS,8aS,11R,12aR,14aR)-3-acetyloxy-11-[(dimethylamino)methyl]-4,6a,6b,8a,11,14a-hexamethyl-5-propan-2-ylsulfanyl-7,8,9,10,12,12a,13,14-octahydro-5H-picen-2-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(c(C)c1OC(C)=O)C(SC(C)C)C=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(CN(C)C)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C38H57NO4S/c1-23(2)44-29-20-30-36(8,27-19-28(42-25(4)40)33(43-26(5)41)24(3)32(27)29)16-18-38(10)31-21-34(6,22-39(11)12)13-14-35(31,7)15-17-37(30,38)9/h19-20,23,29,31H,13-18,21-22H2,1-12H3/t29?,31-,34-,35-,36+,37-,38+/m1/s1 |
| InChIKey | CBLNANHNMCCLMW-ZVQPGIKLSA-N |
| XLogP | 9.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.94 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|