C31H44O4 — CID 155561647
(2R,4aS,6aS,6aS,14aS,14bR)-10,11-dimethoxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid (PubChem CID 155561647) has the molecular formula C31H44O4 and a molecular weight of 480.69 g/mol. Its IUPAC name is (2R,4aS,6aS,6aS,14aS,14bR)-10,11-dimethoxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid.
| Compound Name | (2R,4aS,6aS,6aS,14aS,14bR)-10,11-dimethoxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid |
|---|---|
| PubChem CID | 155561647 |
| Molecular Formula | C31H44O4 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | (2R,4aS,6aS,6aS,14aS,14bR)-10,11-dimethoxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid |
| SMILES | COc1cc2c(c(C)c1OC)CC=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(C(=O)O)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C31H44O4/c1-19-20-9-10-23-29(4,21(20)17-22(34-7)25(19)35-8)14-16-31(6)24-18-28(3,26(32)33)12-11-27(24,2)13-15-30(23,31)5/h10,17,24H,9,11-16,18H2,1-8H3,(H,32,33)/t24-,27-,28-,29+,30-,31+/m1/s1 |
| InChIKey | VMNAVSAJUZBTCQ-ZRCCSVPJSA-N |
| XLogP | 7.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|