C29H39NaO7S — CID 42630195
sodium (6aS,6bS,8aS,11R,12aR,14aR)-11-carboxy-2,3-dihydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydro-5H-picene-5-sulfonate (PubChem CID 42630195) has the molecular formula C29H39NaO7S and a molecular weight of 554.68 g/mol. Its IUPAC name is sodium (6aS,6bS,8aS,11R,12aR,14aR)-11-carboxy-2,3-dihydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydro-5H-picene-5-sulfonate.
| Compound Name | sodium (6aS,6bS,8aS,11R,12aR,14aR)-11-carboxy-2,3-dihydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydro-5H-picene-5-sulfonate |
|---|---|
| PubChem CID | 42630195 |
| Molecular Formula | C29H39NaO7S |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | sodium (6aS,6bS,8aS,11R,12aR,14aR)-11-carboxy-2,3-dihydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydro-5H-picene-5-sulfonate |
| SMILES | Cc1c(O)c(O)cc2c1C(S(=O)(=O)[O-])C=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(C(=O)O)CC[C@]3(C)CC[C@]12C.[Na+] |
| InChI | InChI=1S/C29H40O7S.Na/c1-16-22-17(13-18(30)23(16)31)27(4)10-12-29(6)21-15-26(3,24(32)33)8-7-25(21,2)9-11-28(29,5)20(27)14-19(22)37(34,35)36;/h13-14,19,21,30-31H,7-12,15H2,1-6H3,(H,32,33)(H,34,35,36);/q;+1/p-1/t19?,21-,25-,26-,27+,28-,29+;/m1./s1 |
| InChIKey | OTWRHQIFVNOFIE-RECVLBIZSA-M |
| XLogP | 2.69 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|