C30H40O5 — CID 146609688
(2R,4aS,6aR,6aS,14aS,14bR)-14a-ethyl-10,11-dihydroxy-2,4a,6a,6a,9-pentamethyl-8-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylic acid (PubChem CID 146609688) has the molecular formula C30H40O5 and a molecular weight of 480.65 g/mol. Its IUPAC name is (2R,4aS,6aR,6aS,14aS,14bR)-14a-ethyl-10,11-dihydroxy-2,4a,6a,6a,9-pentamethyl-8-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylic acid.
| Compound Name | (2R,4aS,6aR,6aS,14aS,14bR)-14a-ethyl-10,11-dihydroxy-2,4a,6a,6a,9-pentamethyl-8-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylic acid |
|---|---|
| PubChem CID | 146609688 |
| Molecular Formula | C30H40O5 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | (2R,4aS,6aR,6aS,14aS,14bR)-14a-ethyl-10,11-dihydroxy-2,4a,6a,6a,9-pentamethyl-8-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylic acid |
| SMILES | CC[C@@]12CC[C@]3(C)C(=CC(=O)c4c3cc(O)c(O)c4C)[C@@]1(C)CC[C@@]1(C)CC[C@@](C)(C(=O)O)C[C@H]12 |
| InChI | InChI=1S/C30H40O5/c1-7-30-13-11-28(5)18-14-20(32)24(33)17(2)23(18)19(31)15-21(28)29(30,6)12-10-26(3)8-9-27(4,25(34)35)16-22(26)30/h14-15,22,32-33H,7-13,16H2,1-6H3,(H,34,35)/t22-,26-,27-,28+,29-,30+/m1/s1 |
| InChIKey | YIGSXTSIRIUZGP-NLVUKCNFSA-N |
| XLogP | 6.67 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|