C33H48O4 — CID 146223432
methyl (2R,4aS,6aS,6aS,14aS,14bR)-14a-ethyl-10,11-dimethoxy-2,4a,6a,6a,9-pentamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylate (PubChem CID 146223432) has the molecular formula C33H48O4 and a molecular weight of 508.74 g/mol. Its IUPAC name is methyl (2R,4aS,6aS,6aS,14aS,14bR)-14a-ethyl-10,11-dimethoxy-2,4a,6a,6a,9-pentamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylate.
| Compound Name | methyl (2R,4aS,6aS,6aS,14aS,14bR)-14a-ethyl-10,11-dimethoxy-2,4a,6a,6a,9-pentamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylate |
|---|---|
| PubChem CID | 146223432 |
| Molecular Formula | C33H48O4 |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.36 |
| IUPAC Name | methyl (2R,4aS,6aS,6aS,14aS,14bR)-14a-ethyl-10,11-dimethoxy-2,4a,6a,6a,9-pentamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylate |
| SMILES | CC[C@@]12CC[C@]3(C)C(=CCc4c3cc(OC)c(OC)c4C)[C@@]1(C)CC[C@@]1(C)CC[C@@](C)(C(=O)OC)C[C@H]12 |
| InChI | InChI=1S/C33H48O4/c1-10-33-18-16-31(5)23-19-24(35-7)27(36-8)21(2)22(23)11-12-25(31)32(33,6)17-15-29(3)13-14-30(4,20-26(29)33)28(34)37-9/h12,19,26H,10-11,13-18,20H2,1-9H3/t26-,29-,30-,31+,32-,33+/m1/s1 |
| InChIKey | CAJUEWZEQMIAJI-CDKFMWKUSA-N |
| XLogP | 7.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|