C33H46O4 — CID 129067594
[(6aS,6bS,8aR,12aR,14aS)-3-acetyloxy-4,6a,6b,8a,11,11,14a-heptamethyl-7,8,9,10,12,12a,13,14-octahydro-5H-picen-2-yl] acetate (PubChem CID 129067594) has the molecular formula C33H46O4 and a molecular weight of 506.73 g/mol. Its IUPAC name is [(6aS,6bS,8aR,12aR,14aS)-3-acetyloxy-4,6a,6b,8a,11,11,14a-heptamethyl-7,8,9,10,12,12a,13,14-octahydro-5H-picen-2-yl] acetate.
| Compound Name | [(6aS,6bS,8aR,12aR,14aS)-3-acetyloxy-4,6a,6b,8a,11,11,14a-heptamethyl-7,8,9,10,12,12a,13,14-octahydro-5H-picen-2-yl] acetate |
|---|---|
| PubChem CID | 129067594 |
| Molecular Formula | C33H46O4 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | [(6aS,6bS,8aR,12aR,14aS)-3-acetyloxy-4,6a,6b,8a,11,11,14a-heptamethyl-7,8,9,10,12,12a,13,14-octahydro-5H-picen-2-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(c(C)c1OC(C)=O)CC=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3CC(C)(C)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C33H46O4/c1-20-23-10-11-26-31(7,24(23)18-25(36-21(2)34)28(20)37-22(3)35)15-17-33(9)27-19-29(4,5)12-13-30(27,6)14-16-32(26,33)8/h11,18,27H,10,12-17,19H2,1-9H3/t27-,30-,31+,32-,33+/m1/s1 |
| InChIKey | LKENRHNVMBMNSN-XITZMZQWSA-N |
| XLogP | 8.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|