C36H45F3O6S — CID 129067433
[(6aS,6bS,8aS,11R,12aR,14aR)-3-acetyloxy-11-formyl-4,6a,6b,8a,11,14a-hexamethyl-5-(3,3,3-trifluoropropanoylsulfanyl)-7,8,9,10,12,12a,13,14-octahydro-5H-picen-2-yl] acetate (PubChem CID 129067433) has the molecular formula C36H45F3O6S and a molecular weight of 662.81 g/mol. Its IUPAC name is [(6aS,6bS,8aS,11R,12aR,14aR)-3-acetyloxy-11-formyl-4,6a,6b,8a,11,14a-hexamethyl-5-(3,3,3-trifluoropropanoylsulfanyl)-7,8,9,10,12,12a,13,14-octahydro-5H-picen-2-yl] acetate.
| Compound Name | [(6aS,6bS,8aS,11R,12aR,14aR)-3-acetyloxy-11-formyl-4,6a,6b,8a,11,14a-hexamethyl-5-(3,3,3-trifluoropropanoylsulfanyl)-7,8,9,10,12,12a,13,14-octahydro-5H-picen-2-yl] acetate |
|---|---|
| PubChem CID | 129067433 |
| Molecular Formula | C36H45F3O6S |
| Molecular Weight | 662.81 g/mol |
| Exact Mass | 662.29 |
| IUPAC Name | [(6aS,6bS,8aS,11R,12aR,14aR)-3-acetyloxy-11-formyl-4,6a,6b,8a,11,14a-hexamethyl-5-(3,3,3-trifluoropropanoylsulfanyl)-7,8,9,10,12,12a,13,14-octahydro-5H-picen-2-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(c(C)c1OC(C)=O)C(SC(=O)CC(F)(F)F)C=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(C=O)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C36H45F3O6S/c1-20-29-23(15-24(44-21(2)41)30(20)45-22(3)42)33(6)12-14-35(8)27-17-31(4,19-40)9-10-32(27,5)11-13-34(35,7)26(33)16-25(29)46-28(43)18-36(37,38)39/h15-16,19,25,27H,9-14,17-18H2,1-8H3/t25?,27-,31-,32-,33+,34-,35+/m1/s1 |
| InChIKey | RDSNTIKTPNVKHJ-XQAISXTASA-N |
| XLogP | 8.91 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.81 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|