C39H48O5S — CID 145301036
[(6aS,6bS,8aR,11S,12aR,14aR)-3-acetyloxy-5-benzoylsulfanyl-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,11,12,12a,13,14-decahydropicen-2-yl] acetate (PubChem CID 145301036) has the molecular formula C39H48O5S and a molecular weight of 628.88 g/mol. Its IUPAC name is [(6aS,6bS,8aR,11S,12aR,14aR)-3-acetyloxy-5-benzoylsulfanyl-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,11,12,12a,13,14-decahydropicen-2-yl] acetate.
| Compound Name | [(6aS,6bS,8aR,11S,12aR,14aR)-3-acetyloxy-5-benzoylsulfanyl-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,11,12,12a,13,14-decahydropicen-2-yl] acetate |
|---|---|
| PubChem CID | 145301036 |
| Molecular Formula | C39H48O5S |
| Molecular Weight | 628.88 g/mol |
| Exact Mass | 628.32 |
| IUPAC Name | [(6aS,6bS,8aR,11S,12aR,14aR)-3-acetyloxy-5-benzoylsulfanyl-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,11,12,12a,13,14-decahydropicen-2-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(c(C)c1OC(C)=O)C(SC(=O)c1ccccc1)C=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@@H](C)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C39H48O5S/c1-23-14-15-36(5)16-18-39(8)32-22-30(45-35(42)27-12-10-9-11-13-27)33-24(2)34(44-26(4)41)29(43-25(3)40)21-28(33)37(32,6)17-19-38(39,7)31(36)20-23/h9-13,21-23,30-31H,14-20H2,1-8H3/t23-,30?,31+,36+,37-,38-,39+/m0/s1 |
| InChIKey | YXAFDDYLJGVXPZ-VXRIEQDMSA-N |
| XLogP | 9.70 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.88 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|