C38H49NO5 — CID 145435966
(5R,6aS,6bS,8aR,11S,12aR,14aR)-5-(4-methoxy-1H-indol-3-yl)-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,11,12,12a,13,14-decahydropicene-2,3-diol;formic acid (PubChem CID 145435966) has the molecular formula C38H49NO5 and a molecular weight of 599.81 g/mol. Its IUPAC name is (5R,6aS,6bS,8aR,11S,12aR,14aR)-5-(4-methoxy-1H-indol-3-yl)-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,11,12,12a,13,14-decahydropicene-2,3-diol;formic acid.
| Compound Name | (5R,6aS,6bS,8aR,11S,12aR,14aR)-5-(4-methoxy-1H-indol-3-yl)-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,11,12,12a,13,14-decahydropicene-2,3-diol;formic acid |
|---|---|
| PubChem CID | 145435966 |
| Molecular Formula | C38H49NO5 |
| Molecular Weight | 599.81 g/mol |
| Exact Mass | 599.36 |
| IUPAC Name | (5R,6aS,6bS,8aR,11S,12aR,14aR)-5-(4-methoxy-1H-indol-3-yl)-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,11,12,12a,13,14-decahydropicene-2,3-diol;formic acid |
| SMILES | COc1cccc2[nH]cc([C@@H]3C=C4[C@@](C)(CC[C@@]5(C)[C@@H]6C[C@@H](C)CC[C@]6(C)CC[C@]45C)c4cc(O)c(O)c(C)c43)c12.O=CO |
| InChI | InChI=1S/C37H47NO3.CH2O2/c1-21-11-12-34(3)13-15-37(6)30-18-23(24-20-38-26-9-8-10-28(41-7)32(24)26)31-22(2)33(40)27(39)19-25(31)35(30,4)14-16-36(37,5)29(34)17-21;2-1-3/h8-10,18-21,23,29,38-40H,11-17H2,1-7H3;1H,(H,2,3)/t21-,23-,29+,34+,35-,36-,37+;/m0./s1 |
| InChIKey | IEYILFMHPBXYRB-SSOCPGLLSA-N |
| XLogP | 8.97 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.81 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|