C38H44N2O4 — CID 138623630
(2R,4aS,6aR,6aS,14aS,14bR)-8-(5-cyano-1H-indol-3-yl)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid (PubChem CID 138623630) has the molecular formula C38H44N2O4 and a molecular weight of 592.78 g/mol. Its IUPAC name is (2R,4aS,6aR,6aS,14aS,14bR)-8-(5-cyano-1H-indol-3-yl)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid.
| Compound Name | (2R,4aS,6aR,6aS,14aS,14bR)-8-(5-cyano-1H-indol-3-yl)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid |
|---|---|
| PubChem CID | 138623630 |
| Molecular Formula | C38H44N2O4 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | (2R,4aS,6aR,6aS,14aS,14bR)-8-(5-cyano-1H-indol-3-yl)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid |
| SMILES | Cc1c(O)c(O)cc2c1C(c1c[nH]c3ccc(C#N)cc13)C=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(C(=O)O)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C38H44N2O4/c1-21-31-24(25-20-40-27-8-7-22(19-39)15-23(25)27)16-29-36(4,26(31)17-28(41)32(21)42)12-14-38(6)30-18-35(3,33(43)44)10-9-34(30,2)11-13-37(29,38)5/h7-8,15-17,20,24,30,40-42H,9-14,18H2,1-6H3,(H,43,44)/t24?,30-,34-,35-,36+,37-,38+/m1/s1 |
| InChIKey | CTIKEARXNUUIPT-WCOBAZLASA-N |
| XLogP | 8.59 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|