C36H49NO5S — CID 146609914
[(6aS,6bS,8aS,11R,12aR,14aR)-5-acetylsulfanyl-11-carbamoyl-4,6a,6b,8a,11,14a-hexamethyl-2-prop-1-en-2-yloxy-7,8,9,10,12,12a,13,14-octahydro-5H-picen-3-yl] acetate (PubChem CID 146609914) has the molecular formula C36H49NO5S and a molecular weight of 607.86 g/mol. Its IUPAC name is [(6aS,6bS,8aS,11R,12aR,14aR)-5-acetylsulfanyl-11-carbamoyl-4,6a,6b,8a,11,14a-hexamethyl-2-prop-1-en-2-yloxy-7,8,9,10,12,12a,13,14-octahydro-5H-picen-3-yl] acetate.
| Compound Name | [(6aS,6bS,8aS,11R,12aR,14aR)-5-acetylsulfanyl-11-carbamoyl-4,6a,6b,8a,11,14a-hexamethyl-2-prop-1-en-2-yloxy-7,8,9,10,12,12a,13,14-octahydro-5H-picen-3-yl] acetate |
|---|---|
| PubChem CID | 146609914 |
| Molecular Formula | C36H49NO5S |
| Molecular Weight | 607.86 g/mol |
| Exact Mass | 607.33 |
| IUPAC Name | [(6aS,6bS,8aS,11R,12aR,14aR)-5-acetylsulfanyl-11-carbamoyl-4,6a,6b,8a,11,14a-hexamethyl-2-prop-1-en-2-yloxy-7,8,9,10,12,12a,13,14-octahydro-5H-picen-3-yl] acetate |
| SMILES | C=C(C)Oc1cc2c(c(C)c1OC(C)=O)C(SC(C)=O)C=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(C(N)=O)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C36H49NO5S/c1-20(2)41-25-17-24-29(21(3)30(25)42-22(4)38)26(43-23(5)39)18-27-34(24,8)14-16-36(10)28-19-33(7,31(37)40)12-11-32(28,6)13-15-35(27,36)9/h17-18,26,28H,1,11-16,19H2,2-10H3,(H2,37,40)/t26?,28-,32-,33-,34+,35-,36+/m1/s1 |
| InChIKey | SUXSDEKWPCFGQO-YUCMCMBJSA-N |
| XLogP | 8.25 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.86 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|