C41H49NO3 — CID 148561121
(6aR,11R)-12a-ethyl-5-(6-ethynyl-1H-indol-3-yl)-11-(hydroxymethyl)-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,12-hexahydropicene-2,3-diol (PubChem CID 148561121) has the molecular formula C41H49NO3 and a molecular weight of 603.85 g/mol. Its IUPAC name is (6aR,11R)-12a-ethyl-5-(6-ethynyl-1H-indol-3-yl)-11-(hydroxymethyl)-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,12-hexahydropicene-2,3-diol.
| Compound Name | (6aR,11R)-12a-ethyl-5-(6-ethynyl-1H-indol-3-yl)-11-(hydroxymethyl)-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,12-hexahydropicene-2,3-diol |
|---|---|
| PubChem CID | 148561121 |
| Molecular Formula | C41H49NO3 |
| Molecular Weight | 603.85 g/mol |
| Exact Mass | 603.37 |
| IUPAC Name | (6aR,11R)-12a-ethyl-5-(6-ethynyl-1H-indol-3-yl)-11-(hydroxymethyl)-4,6a,6b,8a,11,14a-hexamethyl-5,7,8,9,10,12-hexahydropicene-2,3-diol |
| SMILES | C#Cc1ccc2c(C3C=C4C(C)(C=C[C@]5(C)C4(C)CCC4(C)CC[C@@](C)(CO)CC45CC)c4cc(O)c(O)c(C)c43)c[nH]c2c1 |
| InChI | InChI=1S/C41H49NO3/c1-9-26-11-12-27-29(22-42-31(27)19-26)28-20-33-38(6,30-21-32(44)35(45)25(3)34(28)30)16-18-40(8)39(33,7)17-15-37(5)14-13-36(4,24-43)23-41(37,40)10-2/h1,11-12,16,18-22,28,42-45H,10,13-15,17,23-24H2,2-8H3/t28?,36-,37?,38?,39?,40-,41?/m1/s1 |
| InChIKey | MUZWDYJTBDNBDB-AKRUYOQJSA-N |
| XLogP | 9.16 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.85 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|