4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid

C9H10O2S — CID 767738

IUPAC4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid
SMILESO=C(O)c1csc2c1CCCC2
InChIInChI=1S/C9H10O2S/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h5H,1-4H2,(H,10,11)
InChIKeyTUZZQEHPGHKGRJ-UHFFFAOYSA-N
MW182.24 g/mol
LogP2.33
Rot. Bonds1

About 4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid

4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid (PubChem CID 767738) has the molecular formula C9H10O2S and a molecular weight of 182.24 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid.

Molecular Properties

Compound Name4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid
PubChem CID767738
Molecular FormulaC9H10O2S
Molecular Weight182.24 g/mol
Exact Mass182.04
IUPAC Name4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid
SMILESO=C(O)c1csc2c1CCCC2
InChIInChI=1S/C9H10O2S/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h5H,1-4H2,(H,10,11)
InChIKeyTUZZQEHPGHKGRJ-UHFFFAOYSA-N
XLogP2.33
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.24
LogP ≤ 52.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid?
The IUPAC name of 4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid (CID 767738) is 4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid.
What is the SMILES notation for 4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid?
The canonical SMILES for 4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid is O=C(O)c1csc2c1CCCC2.
What is the InChIKey of 4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid?
The InChIKey is TUZZQEHPGHKGRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h5H,1-4H2,(H,10,11).
What are the key properties of 4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid?
4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid has a molecular weight of 182.24 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid is sourced from PubChem (CID 767738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).